o-Nitrobenzal bromide
1-(dibromomethyl)-2-nitrobenzene
CAS: 65962-15-4
Molecular Formula: C7H5Br2NO2
o-Nitrobenzal bromide - Names and Identifiers
| Name | 1-(dibromomethyl)-2-nitrobenzene |
| Synonyms | LogP o-Nitrobenzal bromide Nifedipine Impurity 23 3-NITRO-O-DIBROMOMETHYL BENZENE 3-Nitro-O-Dibromomethyl Benzene 1-(Dibromomethyl)-2-nitrobenzene o-nitro-α,α-dibromomethylbenzene 1-(dibromomethyl)-2-nitrobenzene Benzene, 1-(dibromomethyl)-2-nitro- benzene, 1-(dibromomethyl)-2-nitro- |
| CAS | 65962-15-4 |
| InChI | InChI=1/C7H5Br2NO2/c8-7(9)5-3-1-2-4-6(5)10(11)12/h1-4,7H |
o-Nitrobenzal bromide - Physico-chemical Properties
| Molecular Formula | C7H5Br2NO2 |
| Molar Mass | 294.93 |
| Density | 2.038±0.06 g/cm3(Predicted) |
| Melting Point | 46℃ |
| Boling Point | 346.8±27.0 °C(Predicted) |
| Flash Point | 163.56°C |
| Vapor Presure | 0mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.656 |
o-Nitrobenzal bromide - Introduction
1-(dibromomethyl)-2-nitrobenzene is an organic compound with the chemical formula C7H5Br2NO2. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: colorless or light yellow solid.
2. solubility: it can be dissolved in organic solvents, such as ethanol and dichloromethane.
3. Melting point: about 58-60°C.
4. Stability: 1-(dibromomethyl)-2-nitrobenzene is relatively stable under normal storage conditions.
Use:
1. Chemical reagent: It can be used as a raw material for dyes and pigments, and can also be used to synthesize other organic compounds.
2. Agriculture: 1-(dibromomethyl)-2-nitrobenzene is also used as an intermediate for pesticides and herbicides.
Preparation Method:
1-(dibromomethyl)-2-nitrobenzene can be synthesized by the following steps:
1. First, the o-dibromo toluene is reacted with nitric acid.
2. Next, the obtained product is appropriately treated and purified to obtain 1-(dibromomethyl)-2-nitrobenzene.
Safety Information:
1. The impact on human health is limited, but laboratory safety guidelines still need to be followed.
2. It may be toxic to aquatic organisms and should be handled and stored carefully to avoid pollution to the environment.
Nature:
1. Appearance: colorless or light yellow solid.
2. solubility: it can be dissolved in organic solvents, such as ethanol and dichloromethane.
3. Melting point: about 58-60°C.
4. Stability: 1-(dibromomethyl)-2-nitrobenzene is relatively stable under normal storage conditions.
Use:
1. Chemical reagent: It can be used as a raw material for dyes and pigments, and can also be used to synthesize other organic compounds.
2. Agriculture: 1-(dibromomethyl)-2-nitrobenzene is also used as an intermediate for pesticides and herbicides.
Preparation Method:
1-(dibromomethyl)-2-nitrobenzene can be synthesized by the following steps:
1. First, the o-dibromo toluene is reacted with nitric acid.
2. Next, the obtained product is appropriately treated and purified to obtain 1-(dibromomethyl)-2-nitrobenzene.
Safety Information:
1. The impact on human health is limited, but laboratory safety guidelines still need to be followed.
2. It may be toxic to aquatic organisms and should be handled and stored carefully to avoid pollution to the environment.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: Nifedipine Impurity 43 Request for quotation
CAS: 65962-15-4
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
CAS: 65962-15-4
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 3-NITRO-O-DIBROMOMETHYL BENZENE Visit Supplier Webpage Request for quotation
CAS: 65962-15-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 65962-15-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Nifedipine Impurity 43 Request for quotation
CAS: 65962-15-4
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
CAS: 65962-15-4
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 3-NITRO-O-DIBROMOMETHYL BENZENE Visit Supplier Webpage Request for quotation
CAS: 65962-15-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 65962-15-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History